C20H32O4 — CID 10308747
(7E,19E)-1,4-dioxacyclodocosa-7,19-diene-6,21-dione (PubChem CID 10308747) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (7E,19E)-1,4-dioxacyclodocosa-7,19-diene-6,21-dione.
| Compound Name | (7E,19E)-1,4-dioxacyclodocosa-7,19-diene-6,21-dione |
|---|---|
| PubChem CID | 10308747 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (7E,19E)-1,4-dioxacyclodocosa-7,19-diene-6,21-dione |
| SMILES | O=C1/C=C/CCCCCCCCCC/C=C/C(=O)COCCOC1 |
| InChI | InChI=1S/C20H32O4/c21-19-13-11-9-7-5-3-1-2-4-6-8-10-12-14-20(22)18-24-16-15-23-17-19/h11-14H,1-10,15-18H2/b13-11+,14-12+ |
| InChIKey | PGAGHLFWSREONW-PHEQNACWSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |