C20H32O4 — CID 10308749
6-decanoyl-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 10308749) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 6-decanoyl-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-decanoyl-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 10308749 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 6-decanoyl-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CCCCCCCCCC(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C20H32O4/c1-6-7-8-9-10-11-12-13-14(21)15-16(22)19(2,3)18(24)20(4,5)17(15)23/h15H,6-13H2,1-5H3 |
| InChIKey | UKYHLLGYGAUXBA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|