About trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one
trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one (PubChem CID 10308806) has the molecular formula C17H25FO2SSi
and a molecular weight of 340.54 g/mol. Its IUPAC name is trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one.
Molecular Properties
| Compound Name | trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one |
| PubChem CID | 10308806 |
| Molecular Formula | C17H25FO2SSi |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)C[C@@H]1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C17H25FO2SSi/c1-17(2,3)22(4,5)20-15-10-13(19)11-16(15)21-14-8-6-12(18)7-9-14/h6-9,15-16H,10-11H2,1-5H3/t15-,16-/m0/s1 |
| InChIKey | BUWPWESRDMSUSD-HOTGVXAUSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one?
The IUPAC name of trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one (CID 10308806) is trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one.
What is the SMILES notation for trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one?
The canonical SMILES for trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one is CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)C[C@@H]1Sc1ccc(F)cc1.
What is the InChIKey of trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one?
The InChIKey is BUWPWESRDMSUSD-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H25FO2SSi/c1-17(2,3)22(4,5)20-15-10-13(19)11-16(15)21-14-8-6-12(18)7-9-14/h6-9,15-16H,10-11H2,1-5H3/t15-,16-/m0/s1.
What are the key properties of trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one?
trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one has a molecular weight of 340.54 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one is sourced from PubChem (CID 10308806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).