C21H15ClN2O — CID 10308885
(2-chloro-4-ethynylphenyl)-(6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methanone (PubChem CID 10308885) has the molecular formula C21H15ClN2O and a molecular weight of 346.82 g/mol. Its IUPAC name is (2-chloro-4-ethynylphenyl)-(6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methanone.
| Compound Name | (2-chloro-4-ethynylphenyl)-(6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methanone |
|---|---|
| PubChem CID | 10308885 |
| Molecular Formula | C21H15ClN2O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (2-chloro-4-ethynylphenyl)-(6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepin-5-yl)methanone |
| SMILES | C#Cc1ccc(C(=O)N2Cc3cccn3Cc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C21H15ClN2O/c1-2-15-9-10-18(19(22)12-15)21(25)24-14-17-7-5-11-23(17)13-16-6-3-4-8-20(16)24/h1,3-12H,13-14H2 |
| InChIKey | BUAFJZDTLNWHPF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|