C12H28N2S2 — CID 103089079
2-N-methyl-5-methylsulfanyl-2-N-(4-methylsulfanylbutan-2-yl)pentane-1,2-diamine (PubChem CID 103089079) has the molecular formula C12H28N2S2 and a molecular weight of 264.50 g/mol. Its IUPAC name is 2-N-methyl-5-methylsulfanyl-2-N-(4-methylsulfanylbutan-2-yl)pentane-1,2-diamine.
| Compound Name | 2-N-methyl-5-methylsulfanyl-2-N-(4-methylsulfanylbutan-2-yl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 103089079 |
| Molecular Formula | C12H28N2S2 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 2-N-methyl-5-methylsulfanyl-2-N-(4-methylsulfanylbutan-2-yl)pentane-1,2-diamine |
| SMILES | CSCCCC(CN)N(C)C(C)CCSC |
| InChI | InChI=1S/C12H28N2S2/c1-11(7-9-16-4)14(2)12(10-13)6-5-8-15-3/h11-12H,5-10,13H2,1-4H3 |
| InChIKey | WGSIWILCOVUXAW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|