C18H18N6O2 — CID 10308937
8-(1-benzylpyrazol-4-yl)-1-propyl-3,7-dihydropurine-2,6-dione (PubChem CID 10308937) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 8-(1-benzylpyrazol-4-yl)-1-propyl-3,7-dihydropurine-2,6-dione.
| Compound Name | 8-(1-benzylpyrazol-4-yl)-1-propyl-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 10308937 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 8-(1-benzylpyrazol-4-yl)-1-propyl-3,7-dihydropurine-2,6-dione |
| SMILES | CCCn1c(=O)[nH]c2nc(-c3cnn(Cc4ccccc4)c3)[nH]c2c1=O |
| InChI | InChI=1S/C18H18N6O2/c1-2-8-24-17(25)14-16(22-18(24)26)21-15(20-14)13-9-19-23(11-13)10-12-6-4-3-5-7-12/h3-7,9,11H,2,8,10H2,1H3,(H,20,21)(H,22,26) |
| InChIKey | KAYVCWBEIZTVCN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |