C9H17NO2S — CID 103090466
1-(4-methylsulfanylbutyl)azetidine-3-carboxylic acid (PubChem CID 103090466) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-(4-methylsulfanylbutyl)azetidine-3-carboxylic acid.
| Compound Name | 1-(4-methylsulfanylbutyl)azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 103090466 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 1-(4-methylsulfanylbutyl)azetidine-3-carboxylic acid |
| SMILES | CSCCCCN1CC(C(=O)O)C1 |
| InChI | InChI=1S/C9H17NO2S/c1-13-5-3-2-4-10-6-8(7-10)9(11)12/h8H,2-7H2,1H3,(H,11,12) |
| InChIKey | JRIWIMDDDXPBAT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|