About 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid
2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (PubChem CID 103090493) has the molecular formula C11H21NO4S2
and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| PubChem CID | 103090493 |
| Molecular Formula | C11H21NO4S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid |
| SMILES | CSCCCCN1CCS(=O)(=O)CC1CC(=O)O |
| InChI | InChI=1S/C11H21NO4S2/c1-17-6-3-2-4-12-5-7-18(15,16)9-10(12)8-11(13)14/h10H,2-9H2,1H3,(H,13,14) |
| InChIKey | XEEONNRLKSESMA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid?
The IUPAC name of 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid (CID 103090493) is 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid.
What is the SMILES notation for 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid?
The canonical SMILES for 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid is CSCCCCN1CCS(=O)(=O)CC1CC(=O)O.
What is the InChIKey of 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid?
The InChIKey is XEEONNRLKSESMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO4S2/c1-17-6-3-2-4-12-5-7-18(15,16)9-10(12)8-11(13)14/h10H,2-9H2,1H3,(H,13,14).
What are the key properties of 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid?
2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid has a molecular weight of 295.43 g/mol, XLogP of 0.70, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-methylsulfanylbutyl)-1,1-dioxo-1,4-thiazinan-3-yl]acetic acid is sourced from PubChem (CID 103090493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).