C20H26N2O4 — CID 10309062
4,4-diethyl-3-[3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 10309062) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4,4-diethyl-3-[3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | 4,4-diethyl-3-[3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10309062 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 4,4-diethyl-3-[3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | CCC1(CC)COC(=O)N1C(=O)C1CC(c2c(C)cc(C)cc2C)=NO1 |
| InChI | InChI=1S/C20H26N2O4/c1-6-20(7-2)11-25-19(24)22(20)18(23)16-10-15(21-26-16)17-13(4)8-12(3)9-14(17)5/h8-9,16H,6-7,10-11H2,1-5H3 |
| InChIKey | FUEHUNGWXVCTAO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |