About 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid
4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 103090709) has the molecular formula C10H17F2NO4
and a molecular weight of 253.24 g/mol. Its IUPAC name is 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid |
| PubChem CID | 103090709 |
| Molecular Formula | C10H17F2NO4 |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)(CC(=O)NCCOCC(F)F)C(=O)O |
| InChI | InChI=1S/C10H17F2NO4/c1-10(2,9(15)16)5-8(14)13-3-4-17-6-7(11)12/h7H,3-6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | RCOSNQSTWOQAOS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid (CID 103090709) is 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid is CC(C)(CC(=O)NCCOCC(F)F)C(=O)O.
What is the InChIKey of 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid?
The InChIKey is RCOSNQSTWOQAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO4/c1-10(2,9(15)16)5-8(14)13-3-4-17-6-7(11)12/h7H,3-6H2,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid?
4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid has a molecular weight of 253.24 g/mol, XLogP of 0.89, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,2-difluoroethoxy)ethylamino]-2,2-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103090709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).