About 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea
1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea (PubChem CID 103090718) has the molecular formula C11H20F2N2OS
and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea |
| PubChem CID | 103090718 |
| Molecular Formula | C11H20F2N2OS |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea |
| SMILES | FC(F)COCCNC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C11H20F2N2OS/c12-10(13)8-16-7-6-14-11(17)15-9-4-2-1-3-5-9/h9-10H,1-8H2,(H2,14,15,17) |
| InChIKey | DJZLCEWYRXMODJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea?
The IUPAC name of 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea (CID 103090718) is 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea.
What is the SMILES notation for 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea?
The canonical SMILES for 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea is FC(F)COCCNC(=S)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea?
The InChIKey is DJZLCEWYRXMODJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2OS/c12-10(13)8-16-7-6-14-11(17)15-9-4-2-1-3-5-9/h9-10H,1-8H2,(H2,14,15,17).
What are the key properties of 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea?
1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea has a molecular weight of 266.36 g/mol, XLogP of 2.06, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[2-(2,2-difluoroethoxy)ethyl]thiourea is sourced from PubChem (CID 103090718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).