C10H19F2N3O — CID 103090729
1-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine (PubChem CID 103090729) has the molecular formula C10H19F2N3O and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 103090729 |
| Molecular Formula | C10H19F2N3O |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1-cyclopentyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine |
| SMILES | N/C(=N\CCOCC(F)F)NC1CCCC1 |
| InChI | InChI=1S/C10H19F2N3O/c11-9(12)7-16-6-5-14-10(13)15-8-3-1-2-4-8/h8-9H,1-7H2,(H3,13,14,15) |
| InChIKey | MBJRRPYZTVPWDH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|