C11H21F2N3O — CID 103090732
1-cyclohexyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine (PubChem CID 103090732) has the molecular formula C11H21F2N3O and a molecular weight of 249.30 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 103090732 |
| Molecular Formula | C11H21F2N3O |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 1-cyclohexyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine |
| SMILES | N/C(=N\CCOCC(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C11H21F2N3O/c12-10(13)8-17-7-6-15-11(14)16-9-4-2-1-3-5-9/h9-10H,1-8H2,(H3,14,15,16) |
| InChIKey | QUNGUEGHSNZJGN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|