C18H17F3N4O — CID 10309119
N'-[7-[3-(trifluoromethoxy)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine (PubChem CID 10309119) has the molecular formula C18H17F3N4O and a molecular weight of 362.36 g/mol. Its IUPAC name is N'-[7-[3-(trifluoromethoxy)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[7-[3-(trifluoromethoxy)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10309119 |
| Molecular Formula | C18H17F3N4O |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N'-[7-[3-(trifluoromethoxy)phenyl]-1,6-naphthyridin-5-yl]propane-1,3-diamine |
| SMILES | NCCCNc1nc(-c2cccc(OC(F)(F)F)c2)cc2ncccc12 |
| InChI | InChI=1S/C18H17F3N4O/c19-18(20,21)26-13-5-1-4-12(10-13)15-11-16-14(6-2-8-23-16)17(25-15)24-9-3-7-22/h1-2,4-6,8,10-11H,3,7,9,22H2,(H,24,25) |
| InChIKey | JYDBMWYHCQHXMH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|