C19H38O4S — CID 10309131
2,3-dihydroxypropyl 2-tetradecylsulfanylacetate (PubChem CID 10309131) has the molecular formula C19H38O4S and a molecular weight of 362.58 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-tetradecylsulfanylacetate.
| Compound Name | 2,3-dihydroxypropyl 2-tetradecylsulfanylacetate |
|---|---|
| PubChem CID | 10309131 |
| Molecular Formula | C19H38O4S |
| Molecular Weight | 362.58 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2,3-dihydroxypropyl 2-tetradecylsulfanylacetate |
| SMILES | CCCCCCCCCCCCCCSCC(=O)OCC(O)CO |
| InChI | InChI=1S/C19H38O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-24-17-19(22)23-16-18(21)15-20/h18,20-21H,2-17H2,1H3 |
| InChIKey | LSEBRDUEVHOZIP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|