About 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid
5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid (PubChem CID 103091329) has the molecular formula C9H10BrF2NO5S2
and a molecular weight of 394.22 g/mol. Its IUPAC name is 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid |
| PubChem CID | 103091329 |
| Molecular Formula | C9H10BrF2NO5S2 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 392.92 |
| IUPAC Name | 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCOCC(F)F)c(Br)s1 |
| InChI | InChI=1S/C9H10BrF2NO5S2/c10-8-6(3-5(19-8)9(14)15)20(16,17)13-1-2-18-4-7(11)12/h3,7,13H,1-2,4H2,(H,14,15) |
| InChIKey | WQBPUJDEQAKCNW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid (CID 103091329) is 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid is O=C(O)c1cc(S(=O)(=O)NCCOCC(F)F)c(Br)s1.
What is the InChIKey of 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid?
The InChIKey is WQBPUJDEQAKCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrF2NO5S2/c10-8-6(3-5(19-8)9(14)15)20(16,17)13-1-2-18-4-7(11)12/h3,7,13H,1-2,4H2,(H,14,15).
What are the key properties of 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid?
5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid has a molecular weight of 394.22 g/mol, XLogP of 1.77, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-[2-(2,2-difluoroethoxy)ethylsulfamoyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 103091329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).