About (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine
(E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine (PubChem CID 103091698) has the molecular formula C11H13F2N
and a molecular weight of 197.23 g/mol. Its IUPAC name is (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine.
Molecular Properties
| Compound Name | (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine |
| PubChem CID | 103091698 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine |
| SMILES | C/C(=C\c1ccc(F)c(F)c1)C(C)N |
| InChI | InChI=1S/C11H13F2N/c1-7(8(2)14)5-9-3-4-10(12)11(13)6-9/h3-6,8H,14H2,1-2H3/b7-5+ |
| InChIKey | YRURGWKZRPTXSF-FNORWQNLSA-N |
| XLogP | 2.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine?
The IUPAC name of (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine (CID 103091698) is (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine.
What is the SMILES notation for (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine?
The canonical SMILES for (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine is C/C(=C\c1ccc(F)c(F)c1)C(C)N.
What is the InChIKey of (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine?
The InChIKey is YRURGWKZRPTXSF-FNORWQNLSA-N. The full InChI is InChI=1S/C11H13F2N/c1-7(8(2)14)5-9-3-4-10(12)11(13)6-9/h3-6,8H,14H2,1-2H3/b7-5+.
What are the key properties of (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine?
(E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine has a molecular weight of 197.23 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(3,4-difluorophenyl)-3-methylbut-3-en-2-amine is sourced from PubChem (CID 103091698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).