C22H23F2N3O — CID 10309430
(E,2R,3S)-2-(2,4-difluorophenyl)-3-methyl-6-(4-methylphenyl)-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol (PubChem CID 10309430) has the molecular formula C22H23F2N3O and a molecular weight of 383.44 g/mol. Its IUPAC name is (E,2R,3S)-2-(2,4-difluorophenyl)-3-methyl-6-(4-methylphenyl)-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol.
| Compound Name | (E,2R,3S)-2-(2,4-difluorophenyl)-3-methyl-6-(4-methylphenyl)-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 10309430 |
| Molecular Formula | C22H23F2N3O |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (E,2R,3S)-2-(2,4-difluorophenyl)-3-methyl-6-(4-methylphenyl)-1-(1,2,4-triazol-1-yl)hex-5-en-2-ol |
| SMILES | Cc1ccc(/C=C/C[C@H](C)[C@](O)(Cn2cncn2)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C22H23F2N3O/c1-16-6-8-18(9-7-16)5-3-4-17(2)22(28,13-27-15-25-14-26-27)20-11-10-19(23)12-21(20)24/h3,5-12,14-15,17,28H,4,13H2,1-2H3/b5-3+/t17-,22+/m0/s1 |
| InChIKey | LXUDXQJADZOQOM-FYHGARGNSA-N |
| XLogP | 4.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |