About 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid
3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid (PubChem CID 10309462) has the molecular formula C20H36NO4P
and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid.
Molecular Properties
| Compound Name | 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid |
| PubChem CID | 10309462 |
| Molecular Formula | C20H36NO4P |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid |
| SMILES | CCCCCCCCOc1c(C)cc(CNCCCP(=O)(O)O)cc1C |
| InChI | InChI=1S/C20H36NO4P/c1-4-5-6-7-8-9-12-25-20-17(2)14-19(15-18(20)3)16-21-11-10-13-26(22,23)24/h14-15,21H,4-13,16H2,1-3H3,(H2,22,23,24) |
| InChIKey | YIZUZSSLYPDFOC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid?
The IUPAC name of 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid (CID 10309462) is 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid.
What is the SMILES notation for 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid?
The canonical SMILES for 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid is CCCCCCCCOc1c(C)cc(CNCCCP(=O)(O)O)cc1C.
What is the InChIKey of 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid?
The InChIKey is YIZUZSSLYPDFOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36NO4P/c1-4-5-6-7-8-9-12-25-20-17(2)14-19(15-18(20)3)16-21-11-10-13-26(22,23)24/h14-15,21H,4-13,16H2,1-3H3,(H2,22,23,24).
What are the key properties of 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid?
3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid has a molecular weight of 385.49 g/mol, XLogP of 4.70, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethyl-4-octoxyphenyl)methylamino]propylphosphonic acid is sourced from PubChem (CID 10309462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).