C10H8ClN3O3S — CID 103094687
N-(3-chloro-2-pyridinyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 103094687) has the molecular formula C10H8ClN3O3S and a molecular weight of 285.71 g/mol. Its IUPAC name is N-(3-chloro-2-pyridinyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-(3-chloro-2-pyridinyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103094687 |
| Molecular Formula | C10H8ClN3O3S |
| Molecular Weight | 285.71 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | N-(3-chloro-2-pyridinyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | O=c1ccc(S(=O)(=O)Nc2ncccc2Cl)c[nH]1 |
| InChI | InChI=1S/C10H8ClN3O3S/c11-8-2-1-5-12-10(8)14-18(16,17)7-3-4-9(15)13-6-7/h1-6H,(H,12,14)(H,13,15) |
| InChIKey | YKBMOEBLPJGTIE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.71 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |