C21H27NO6 — CID 10309515
(4S,5R,6Z,9S,10S,12E)-16-(dimethylamino)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione (PubChem CID 10309515) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is (4S,5R,6Z,9S,10S,12E)-16-(dimethylamino)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione.
| Compound Name | (4S,5R,6Z,9S,10S,12E)-16-(dimethylamino)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
|---|---|
| PubChem CID | 10309515 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (4S,5R,6Z,9S,10S,12E)-16-(dimethylamino)-9,10,18-trihydroxy-4,5-dimethyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,12,15,17-pentaene-2,8-dione |
| SMILES | C[C@@H]1/C=C\C(=O)[C@@H](O)[C@@H](O)C/C=C/c2cc(N(C)C)cc(O)c2C(=O)O[C@H]1C |
| InChI | InChI=1S/C21H27NO6/c1-12-8-9-17(24)20(26)16(23)7-5-6-14-10-15(22(3)4)11-18(25)19(14)21(27)28-13(12)2/h5-6,8-13,16,20,23,25-26H,7H2,1-4H3/b6-5+,9-8-/t12-,13+,16+,20+/m1/s1 |
| InChIKey | SSMOUJBHKFEDHM-HMNLTAHHSA-N |
| XLogP | 1.90 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |