C12H19ClN2O — CID 103095705
3-(1-chloropropyl)-5-(4-methylcyclohexyl)-1,2,4-oxadiazole (PubChem CID 103095705) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 3-(1-chloropropyl)-5-(4-methylcyclohexyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chloropropyl)-5-(4-methylcyclohexyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103095705 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-(1-chloropropyl)-5-(4-methylcyclohexyl)-1,2,4-oxadiazole |
| SMILES | CCC(Cl)c1noc(C2CCC(C)CC2)n1 |
| InChI | InChI=1S/C12H19ClN2O/c1-3-10(13)11-14-12(16-15-11)9-6-4-8(2)5-7-9/h8-10H,3-7H2,1-2H3 |
| InChIKey | YVFJRNDOPFMTRN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|