C25H31NO3 — CID 10309581
(E)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylhex-2-enamide (PubChem CID 10309581) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylhex-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylhex-2-enamide |
|---|---|
| PubChem CID | 10309581 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylhex-2-enamide |
| SMILES | CC(C)C/C(=C\C(=O)Nc1ccc2c(c1)OCCO2)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H31NO3/c1-17(2)14-19(18-6-8-20(9-7-18)25(3,4)5)15-24(27)26-21-10-11-22-23(16-21)29-13-12-28-22/h6-11,15-17H,12-14H2,1-5H3,(H,26,27)/b19-15+ |
| InChIKey | SHGJSGCAJRTIIG-XDJHFCHBSA-N |
| XLogP | 5.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|