C14H13ClN2OS — CID 103096007
5-(1-benzothiophen-2-yl)-3-(1-chlorobutyl)-1,2,4-oxadiazole (PubChem CID 103096007) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is 5-(1-benzothiophen-2-yl)-3-(1-chlorobutyl)-1,2,4-oxadiazole.
| Compound Name | 5-(1-benzothiophen-2-yl)-3-(1-chlorobutyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103096007 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 5-(1-benzothiophen-2-yl)-3-(1-chlorobutyl)-1,2,4-oxadiazole |
| SMILES | CCCC(Cl)c1noc(-c2cc3ccccc3s2)n1 |
| InChI | InChI=1S/C14H13ClN2OS/c1-2-5-10(15)13-16-14(18-17-13)12-8-9-6-3-4-7-11(9)19-12/h3-4,6-8,10H,2,5H2,1H3 |
| InChIKey | ZSPYPFHBLCWKTL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|