C9H12ClF3N2O — CID 103096072
3-(1-chlorobutyl)-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole (PubChem CID 103096072) has the molecular formula C9H12ClF3N2O and a molecular weight of 256.65 g/mol. Its IUPAC name is 3-(1-chlorobutyl)-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1-chlorobutyl)-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103096072 |
| Molecular Formula | C9H12ClF3N2O |
| Molecular Weight | 256.65 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-(1-chlorobutyl)-5-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
| SMILES | CCCC(Cl)c1noc(CCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H12ClF3N2O/c1-2-3-6(10)8-14-7(16-15-8)4-5-9(11,12)13/h6H,2-5H2,1H3 |
| InChIKey | YBSRXMZERCMKBE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.65 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|