About 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol
3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol (PubChem CID 103096689) has the molecular formula C10H21F2NO
and a molecular weight of 209.28 g/mol. Its IUPAC name is 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol |
| PubChem CID | 103096689 |
| Molecular Formula | C10H21F2NO |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol |
| SMILES | CC(NC(CCO)C(C)(C)C)C(F)F |
| InChI | InChI=1S/C10H21F2NO/c1-7(9(11)12)13-8(5-6-14)10(2,3)4/h7-9,13-14H,5-6H2,1-4H3 |
| InChIKey | VRACKDTWDJNXTH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol?
The IUPAC name of 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol (CID 103096689) is 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol?
The canonical SMILES for 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol is CC(NC(CCO)C(C)(C)C)C(F)F.
What is the InChIKey of 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol?
The InChIKey is VRACKDTWDJNXTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F2NO/c1-7(9(11)12)13-8(5-6-14)10(2,3)4/h7-9,13-14H,5-6H2,1-4H3.
What are the key properties of 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol?
3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol has a molecular weight of 209.28 g/mol, XLogP of 2.03, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoropropan-2-ylamino)-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 103096689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).