About N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine (PubChem CID 103096716) has the molecular formula C15H19FN2O
and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine.
Molecular Properties
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine |
| PubChem CID | 103096716 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine |
| SMILES | CCc1cnc(CNC(C)Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C15H19FN2O/c1-3-14-9-18-15(19-14)10-17-11(2)8-12-4-6-13(16)7-5-12/h4-7,9,11,17H,3,8,10H2,1-2H3 |
| InChIKey | CYICMEGOHZUSRG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine?
The IUPAC name of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine (CID 103096716) is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine.
What is the SMILES notation for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine?
The canonical SMILES for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine is CCc1cnc(CNC(C)Cc2ccc(F)cc2)o1.
What is the InChIKey of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine?
The InChIKey is CYICMEGOHZUSRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2O/c1-3-14-9-18-15(19-14)10-17-11(2)8-12-4-6-13(16)7-5-12/h4-7,9,11,17H,3,8,10H2,1-2H3.
What are the key properties of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine?
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine has a molecular weight of 262.33 g/mol, XLogP of 3.10, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-1-(4-fluorophenyl)propan-2-amine is sourced from PubChem (CID 103096716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).