C20H19Cl2N3O2 — CID 10309741
5-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-(furan-2-yl)-1,2,4-oxadiazole (PubChem CID 10309741) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is 5-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-(furan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-(furan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 10309741 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 5-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-(furan-2-yl)-1,2,4-oxadiazole |
| SMILES | CN1C2CC[C@@H]1[C@H](c1nc(-c3ccco3)no1)[C@@H](c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C20H19Cl2N3O2/c1-25-12-5-7-16(25)18(13(10-12)11-4-6-14(21)15(22)9-11)20-23-19(24-27-20)17-3-2-8-26-17/h2-4,6,8-9,12-13,16,18H,5,7,10H2,1H3/t12?,13-,16-,18-/m1/s1 |
| InChIKey | VJFAUNVKEBBPNS-LOHSDJJTSA-N |
| XLogP | 5.37 |
| TPSA | 55.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |