C15H11F2N3O — CID 103097670
N-(2,6-difluoro-3-pyridinyl)-2-(1H-indol-3-yl)acetamide (PubChem CID 103097670) has the molecular formula C15H11F2N3O and a molecular weight of 287.27 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 103097670 |
| Molecular Formula | C15H11F2N3O |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-2-(1H-indol-3-yl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C15H11F2N3O/c16-13-6-5-12(15(17)20-13)19-14(21)7-9-8-18-11-4-2-1-3-10(9)11/h1-6,8,18H,7H2,(H,19,21) |
| InChIKey | DIKNQTFMCVZALF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|