C9H10F2N2O — CID 103097671
N-(2,6-difluoro-3-pyridinyl)-2-methylpropanamide (PubChem CID 103097671) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-2-methylpropanamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 103097671 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C9H10F2N2O/c1-5(2)9(14)12-6-3-4-7(10)13-8(6)11/h3-5H,1-2H3,(H,12,14) |
| InChIKey | PPSPOGXXHKAHTA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|