About 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid
4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid (PubChem CID 10309804) has the molecular formula C23H20O5S
and a molecular weight of 408.48 g/mol. Its IUPAC name is 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid |
| PubChem CID | 10309804 |
| Molecular Formula | C23H20O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid |
| SMILES | COc1cc(OC)c(-c2ccc(C)s2)cc1/C=C/C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H20O5S/c1-14-4-11-22(29-14)18-12-17(20(27-2)13-21(18)28-3)9-10-19(24)15-5-7-16(8-6-15)23(25)26/h4-13H,1-3H3,(H,25,26)/b10-9+ |
| InChIKey | GTPJYPRPOFQLGP-MDZDMXLPSA-N |
| XLogP | 5.34 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid?
The IUPAC name of 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid (CID 10309804) is 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid.
What is the SMILES notation for 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid?
The canonical SMILES for 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid is COc1cc(OC)c(-c2ccc(C)s2)cc1/C=C/C(=O)c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid?
The InChIKey is GTPJYPRPOFQLGP-MDZDMXLPSA-N. The full InChI is InChI=1S/C23H20O5S/c1-14-4-11-22(29-14)18-12-17(20(27-2)13-21(18)28-3)9-10-19(24)15-5-7-16(8-6-15)23(25)26/h4-13H,1-3H3,(H,25,26)/b10-9+.
What are the key properties of 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid?
4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid has a molecular weight of 408.48 g/mol, XLogP of 5.34, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-[2,4-dimethoxy-5-(5-methylthiophen-2-yl)phenyl]prop-2-enoyl]benzoic acid is sourced from PubChem (CID 10309804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).