C6H4F4N2O2S — CID 103098077
N-(2,6-difluoro-3-pyridinyl)-1,1-difluoromethanesulfonamide (PubChem CID 103098077) has the molecular formula C6H4F4N2O2S and a molecular weight of 244.17 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 103098077 |
| Molecular Formula | C6H4F4N2O2S |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-1,1-difluoromethanesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)nc1F)C(F)F |
| InChI | InChI=1S/C6H4F4N2O2S/c7-4-2-1-3(5(8)11-4)12-15(13,14)6(9)10/h1-2,6,12H |
| InChIKey | JVMDGLHZPCBTNF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|