C13H12F2N2O3S — CID 103098110
N-(2,6-difluoro-3-pyridinyl)-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 103098110) has the molecular formula C13H12F2N2O3S and a molecular weight of 314.31 g/mol. Its IUPAC name is N-(2,6-difluoro-3-pyridinyl)-2-methoxy-5-methylbenzenesulfonamide.
| Compound Name | N-(2,6-difluoro-3-pyridinyl)-2-methoxy-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103098110 |
| Molecular Formula | C13H12F2N2O3S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-(2,6-difluoro-3-pyridinyl)-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)Nc1ccc(F)nc1F |
| InChI | InChI=1S/C13H12F2N2O3S/c1-8-3-5-10(20-2)11(7-8)21(18,19)17-9-4-6-12(14)16-13(9)15/h3-7,17H,1-2H3 |
| InChIKey | LQTXTUTWOUGXJJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|