C7H4BrN5O5 — CID 103098307
5-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 103098307) has the molecular formula C7H4BrN5O5 and a molecular weight of 318.04 g/mol. Its IUPAC name is 5-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 103098307 |
| Molecular Formula | C7H4BrN5O5 |
| Molecular Weight | 318.04 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 5-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(Cn2nc([N+](=O)[O-])nc2Br)on1 |
| InChI | InChI=1S/C7H4BrN5O5/c8-6-9-7(13(16)17)10-12(6)2-3-1-4(5(14)15)11-18-3/h1H,2H2,(H,14,15) |
| InChIKey | JKDSIMRJAJLJRA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.04 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|