About 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol
2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol (PubChem CID 103098445) has the molecular formula C6H11BrN4O2
and a molecular weight of 251.08 g/mol. Its IUPAC name is 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol |
| PubChem CID | 103098445 |
| Molecular Formula | C6H11BrN4O2 |
| Molecular Weight | 251.08 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol |
| SMILES | Nc1nc(Br)n(CCOCCO)n1 |
| InChI | InChI=1S/C6H11BrN4O2/c7-5-9-6(8)10-11(5)1-3-13-4-2-12/h12H,1-4H2,(H2,8,10) |
| InChIKey | HTQUGTKCINEGQH-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.08 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol?
The IUPAC name of 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol (CID 103098445) is 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol.
What is the SMILES notation for 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol?
The canonical SMILES for 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol is Nc1nc(Br)n(CCOCCO)n1.
What is the InChIKey of 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol?
The InChIKey is HTQUGTKCINEGQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BrN4O2/c7-5-9-6(8)10-11(5)1-3-13-4-2-12/h12H,1-4H2,(H2,8,10).
What are the key properties of 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol?
2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol has a molecular weight of 251.08 g/mol, XLogP of -0.37, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-amino-5-bromo-1,2,4-triazol-1-yl)ethoxy]ethanol is sourced from PubChem (CID 103098445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).