C11H13BrN6O2 — CID 103099209
5-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-N-propylpyridin-2-amine (PubChem CID 103099209) has the molecular formula C11H13BrN6O2 and a molecular weight of 341.17 g/mol. Its IUPAC name is 5-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-N-propylpyridin-2-amine.
| Compound Name | 5-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 103099209 |
| Molecular Formula | C11H13BrN6O2 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 5-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(Cn2nc([N+](=O)[O-])nc2Br)cn1 |
| InChI | InChI=1S/C11H13BrN6O2/c1-2-5-13-9-4-3-8(6-14-9)7-17-10(12)15-11(16-17)18(19)20/h3-4,6H,2,5,7H2,1H3,(H,13,14) |
| InChIKey | GWHJSZAUPVXSJU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|