C14H14ClF3N2O3S2 — CID 10309921
3-chloro-2-methyl-N-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 10309921) has the molecular formula C14H14ClF3N2O3S2 and a molecular weight of 414.86 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10309921 |
| Molecular Formula | C14H14ClF3N2O3S2 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 3-chloro-2-methyl-N-[5-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1ncc(CCOCC(F)(F)F)s1 |
| InChI | InChI=1S/C14H14ClF3N2O3S2/c1-9-11(15)3-2-4-12(9)25(21,22)20-13-19-7-10(24-13)5-6-23-8-14(16,17)18/h2-4,7H,5-6,8H2,1H3,(H,19,20) |
| InChIKey | VNMBMVBRWGEBPW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|