About [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine
[3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine (PubChem CID 103099247) has the molecular formula C8H8BrN7O2
and a molecular weight of 314.10 g/mol. Its IUPAC name is [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine |
| PubChem CID | 103099247 |
| Molecular Formula | C8H8BrN7O2 |
| Molecular Weight | 314.10 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ncccc1Cn1nc([N+](=O)[O-])nc1Br |
| InChI | InChI=1S/C8H8BrN7O2/c9-7-12-8(16(17)18)14-15(7)4-5-2-1-3-11-6(5)13-10/h1-3H,4,10H2,(H,11,13) |
| InChIKey | VJKQAGXUGYVIEI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.10 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine?
The IUPAC name of [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine (CID 103099247) is [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine.
What is the SMILES notation for [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine?
The canonical SMILES for [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine is NNc1ncccc1Cn1nc([N+](=O)[O-])nc1Br.
What is the InChIKey of [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine?
The InChIKey is VJKQAGXUGYVIEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrN7O2/c9-7-12-8(16(17)18)14-15(7)4-5-2-1-3-11-6(5)13-10/h1-3H,4,10H2,(H,11,13).
What are the key properties of [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine?
[3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine has a molecular weight of 314.10 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(5-bromo-3-nitro-1,2,4-triazol-1-yl)methyl]-2-pyridinyl]hydrazine is sourced from PubChem (CID 103099247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).