About 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide
5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide (PubChem CID 103099366) has the molecular formula C9H14F2N4O2
and a molecular weight of 248.23 g/mol. Its IUPAC name is 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide |
| PubChem CID | 103099366 |
| Molecular Formula | C9H14F2N4O2 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NCCOCC(F)F)c1N |
| InChI | InChI=1S/C9H14F2N4O2/c1-15-8(12)6(4-14-15)9(16)13-2-3-17-5-7(10)11/h4,7H,2-3,5,12H2,1H3,(H,13,16) |
| InChIKey | JEBQIMMSMGTYEL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide?
The IUPAC name of 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide (CID 103099366) is 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide.
What is the SMILES notation for 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide?
The canonical SMILES for 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide is Cn1ncc(C(=O)NCCOCC(F)F)c1N.
What is the InChIKey of 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide?
The InChIKey is JEBQIMMSMGTYEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N4O2/c1-15-8(12)6(4-14-15)9(16)13-2-3-17-5-7(10)11/h4,7H,2-3,5,12H2,1H3,(H,13,16).
What are the key properties of 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide?
5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide has a molecular weight of 248.23 g/mol, XLogP of 0.01, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-[2-(2,2-difluoroethoxy)ethyl]-1-methylpyrazole-4-carboxamide is sourced from PubChem (CID 103099366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).