C25H41FO2Si — CID 10310013
(7R,8S,9S,10R,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-11-fluoro-7,13-dimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 10310013) has the molecular formula C25H41FO2Si and a molecular weight of 420.69 g/mol. Its IUPAC name is (7R,8S,9S,10R,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-11-fluoro-7,13-dimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (7R,8S,9S,10R,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-11-fluoro-7,13-dimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10310013 |
| Molecular Formula | C25H41FO2Si |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (7R,8S,9S,10R,11S,13S,14S,17S)-17-[tert-butyl(dimethyl)silyl]oxy-11-fluoro-7,13-dimethyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC2=CC(=O)CC[C@@H]2[C@@H]2[C@@H]1[C@@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C[C@@H]2F |
| InChI | InChI=1S/C25H41FO2Si/c1-15-12-16-13-17(27)8-9-18(16)23-20(26)14-25(5)19(22(15)23)10-11-21(25)28-29(6,7)24(2,3)4/h13,15,18-23H,8-12,14H2,1-7H3/t15-,18+,19+,20+,21+,22+,23+,25+/m1/s1 |
| InChIKey | TXCMDVYQHBZQTI-DTSYYUKZSA-N |
| XLogP | 6.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|