C10H15N5O2 — CID 103101079
5-amino-2-[(2-amino-2-oxoethyl)-ethylamino]pyridine-3-carboxamide (PubChem CID 103101079) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 5-amino-2-[(2-amino-2-oxoethyl)-ethylamino]pyridine-3-carboxamide.
| Compound Name | 5-amino-2-[(2-amino-2-oxoethyl)-ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103101079 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 5-amino-2-[(2-amino-2-oxoethyl)-ethylamino]pyridine-3-carboxamide |
| SMILES | CCN(CC(N)=O)c1ncc(N)cc1C(N)=O |
| InChI | InChI=1S/C10H15N5O2/c1-2-15(5-8(12)16)10-7(9(13)17)3-6(11)4-14-10/h3-4H,2,5,11H2,1H3,(H2,12,16)(H2,13,17) |
| InChIKey | QFIBBLNAONARAB-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |