C11H13F5N2 — CID 103102090
N'-ethyl-N'-[(2,3,4,5,6-pentafluorophenyl)methyl]ethane-1,2-diamine (PubChem CID 103102090) has the molecular formula C11H13F5N2 and a molecular weight of 268.23 g/mol. Its IUPAC name is N'-ethyl-N'-[(2,3,4,5,6-pentafluorophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[(2,3,4,5,6-pentafluorophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 103102090 |
| Molecular Formula | C11H13F5N2 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N'-ethyl-N'-[(2,3,4,5,6-pentafluorophenyl)methyl]ethane-1,2-diamine |
| SMILES | CCN(CCN)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H13F5N2/c1-2-18(4-3-17)5-6-7(12)9(14)11(16)10(15)8(6)13/h2-5,17H2,1H3 |
| InChIKey | UUFXTKKSWQHNCC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|