About 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide
2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide (PubChem CID 103102432) has the molecular formula C11H15N5O
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide |
| PubChem CID | 103102432 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)c1nnc(C)c(C)c1C#N |
| InChI | InChI=1S/C11H15N5O/c1-4-16(6-10(13)17)11-9(5-12)7(2)8(3)14-15-11/h4,6H2,1-3H3,(H2,13,17) |
| InChIKey | CBZYDBUAAPBKDG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 95.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide?
The IUPAC name of 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide (CID 103102432) is 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide.
What is the SMILES notation for 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide?
The canonical SMILES for 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide is CCN(CC(N)=O)c1nnc(C)c(C)c1C#N.
What is the InChIKey of 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide?
The InChIKey is CBZYDBUAAPBKDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O/c1-4-16(6-10(13)17)11-9(5-12)7(2)8(3)14-15-11/h4,6H2,1-3H3,(H2,13,17).
What are the key properties of 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide?
2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide has a molecular weight of 233.27 g/mol, XLogP of 0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-cyano-5,6-dimethylpyridazin-3-yl)-ethylamino]acetamide is sourced from PubChem (CID 103102432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).