C14H21N3O — CID 103102718
2-[ethyl-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]acetamide (PubChem CID 103102718) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[ethyl-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]acetamide.
| Compound Name | 2-[ethyl-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]acetamide |
|---|---|
| PubChem CID | 103102718 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 2-[ethyl-(2-methyl-1,2,3,4-tetrahydroquinolin-6-yl)amino]acetamide |
| SMILES | CCN(CC(N)=O)c1ccc2c(c1)CCC(C)N2 |
| InChI | InChI=1S/C14H21N3O/c1-3-17(9-14(15)18)12-6-7-13-11(8-12)5-4-10(2)16-13/h6-8,10,16H,3-5,9H2,1-2H3,(H2,15,18) |
| InChIKey | SKYGMVBOSVSXMN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|