C24H25F3N4O — CID 10310362
(2S)-N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(1H-indol-4-yl)phenyl]ethyl]amino]pentanamide (PubChem CID 10310362) has the molecular formula C24H25F3N4O and a molecular weight of 442.49 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(1H-indol-4-yl)phenyl]ethyl]amino]pentanamide.
| Compound Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(1H-indol-4-yl)phenyl]ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 10310362 |
| Molecular Formula | C24H25F3N4O |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (2S)-N-(cyanomethyl)-4-methyl-2-[[(1S)-2,2,2-trifluoro-1-[4-(1H-indol-4-yl)phenyl]ethyl]amino]pentanamide |
| SMILES | CC(C)C[C@H](N[C@@H](c1ccc(-c2cccc3[nH]ccc23)cc1)C(F)(F)F)C(=O)NCC#N |
| InChI | InChI=1S/C24H25F3N4O/c1-15(2)14-21(23(32)30-13-11-28)31-22(24(25,26)27)17-8-6-16(7-9-17)18-4-3-5-20-19(18)10-12-29-20/h3-10,12,15,21-22,29,31H,13-14H2,1-2H3,(H,30,32)/t21-,22-/m0/s1 |
| InChIKey | TVZIAMLRFHJDFH-VXKWHMMOSA-N |
| XLogP | 5.08 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|