About methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate
methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate (PubChem CID 103105804) has the molecular formula C10H13F3N4O3
and a molecular weight of 294.23 g/mol. Its IUPAC name is methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate |
| PubChem CID | 103105804 |
| Molecular Formula | C10H13F3N4O3 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate |
| SMILES | CCc1c(C(=O)OC)nnn1CC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O3/c1-3-6-8(9(19)20-2)15-16-17(6)4-7(18)14-5-10(11,12)13/h3-5H2,1-2H3,(H,14,18) |
| InChIKey | VTYKJQCPISOKIX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate?
The IUPAC name of methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate (CID 103105804) is methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate?
The canonical SMILES for methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate is CCc1c(C(=O)OC)nnn1CC(=O)NCC(F)(F)F.
What is the InChIKey of methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate?
The InChIKey is VTYKJQCPISOKIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N4O3/c1-3-6-8(9(19)20-2)15-16-17(6)4-7(18)14-5-10(11,12)13/h3-5H2,1-2H3,(H,14,18).
What are the key properties of methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate?
methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate has a molecular weight of 294.23 g/mol, XLogP of 0.31, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethyl-1-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]triazole-4-carboxylate is sourced from PubChem (CID 103105804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).