C22H21N9O3 — CID 10310635
4-(furan-2-yl)-10-[2-(7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 10310635) has the molecular formula C22H21N9O3 and a molecular weight of 459.47 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-[2-(7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-[2-(7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 10310635 |
| Molecular Formula | C22H21N9O3 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 4-(furan-2-yl)-10-[2-(7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | Nc1nc2c(cnn2CCN2CCc3ccc([N+](=O)[O-])cc3CC2)c2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C22H21N9O3/c23-22-26-20-17(21-25-19(27-30(21)22)18-2-1-11-34-18)13-24-29(20)10-9-28-7-5-14-3-4-16(31(32)33)12-15(14)6-8-28/h1-4,11-13H,5-10H2,(H2,23,26) |
| InChIKey | FWZQSNQBDAECAU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 146.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|