C10H18N6S2+2 — CID 10310648
1,4,5-trimethyl-3-[(1,4,5-trimethyl-1,2,4-triazol-4-ium-3-yl)disulfanyl]-1,2,4-triazol-4-ium (PubChem CID 10310648) has the molecular formula C10H18N6S2+2 and a molecular weight of 286.43 g/mol. Its IUPAC name is 1,4,5-trimethyl-3-[(1,4,5-trimethyl-1,2,4-triazol-4-ium-3-yl)disulfanyl]-1,2,4-triazol-4-ium.
| Compound Name | 1,4,5-trimethyl-3-[(1,4,5-trimethyl-1,2,4-triazol-4-ium-3-yl)disulfanyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 10310648 |
| Molecular Formula | C10H18N6S2+2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1,4,5-trimethyl-3-[(1,4,5-trimethyl-1,2,4-triazol-4-ium-3-yl)disulfanyl]-1,2,4-triazol-4-ium |
| SMILES | Cc1n(C)nc(SSc2nn(C)c(C)[n+]2C)[n+]1C |
| InChI | InChI=1S/C10H18N6S2/c1-7-13(3)9(11-15(7)5)17-18-10-12-16(6)8(2)14(10)4/h1-6H3/q+2 |
| InChIKey | HGWQIOZIXXLKTC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|