About ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate
ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate (PubChem CID 103107201) has the molecular formula C14H18N4O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate |
| PubChem CID | 103107201 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2nc(C)c(C)o2)c1C1CC1 |
| InChI | InChI=1S/C14H18N4O3/c1-4-20-14(19)12-13(10-5-6-10)18(17-16-12)7-11-15-8(2)9(3)21-11/h10H,4-7H2,1-3H3 |
| InChIKey | WJTFLVFFLFAUIU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate?
The IUPAC name of ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate (CID 103107201) is ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate.
What is the SMILES notation for ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate?
The canonical SMILES for ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate is CCOC(=O)c1nnn(Cc2nc(C)c(C)o2)c1C1CC1.
What is the InChIKey of ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate?
The InChIKey is WJTFLVFFLFAUIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3/c1-4-20-14(19)12-13(10-5-6-10)18(17-16-12)7-11-15-8(2)9(3)21-11/h10H,4-7H2,1-3H3.
What are the key properties of ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate?
ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate has a molecular weight of 290.32 g/mol, XLogP of 1.99, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-cyclopropyl-1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]triazole-4-carboxylate is sourced from PubChem (CID 103107201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).