C14H18BrN3O2S — CID 103108151
ethyl 1-[(4-bromothiophen-2-yl)methyl]-5-(2-methylpropyl)triazole-4-carboxylate (PubChem CID 103108151) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is ethyl 1-[(4-bromothiophen-2-yl)methyl]-5-(2-methylpropyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-[(4-bromothiophen-2-yl)methyl]-5-(2-methylpropyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103108151 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | ethyl 1-[(4-bromothiophen-2-yl)methyl]-5-(2-methylpropyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2cc(Br)cs2)c1CC(C)C |
| InChI | InChI=1S/C14H18BrN3O2S/c1-4-20-14(19)13-12(5-9(2)3)18(17-16-13)7-11-6-10(15)8-21-11/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | HMODFZGRSCGFSZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |